When you click "Institute" at the bottom of the page, the Institute information of the Researcher is shown.
| Revised Date |
2011.08.25 |
| Researcher Name |
IMANAKA Nobuhito
|
| Date of Birth |
1958.09 |
| Organization Name,Department Name,Job Title |
| 1.
|
Osaka University Graduate School of Engineering Division of Applied Chemistry
Department of Applied Chemistry
Professor
|
|
| Fax |
06-6879-7354 |
| Research Field |
Physical chemistry
,Inorganic chemistry
,Functional material chemistry
|
| Keywords for Research Field |
Industrial Physical Chemistry |
| Research Theme |
| 1.
|
Study on Solid Electrolytes
Solid Electrolytes
Research Field：
Functional material chemistry
（Collaboration in Organization）
-
|
| 2.
|
Study on Chemical Sensors
Chemical Sensors
Research Field：
Functional material chemistry
（Collaboration in Organization）
-
|
|
Research Result (papers and notes)
(288cases) |
| 1.
|
Electrical and Thermal Properties of Na2SO4 Doped with NaVO3, Ln2(SO4)3(Ln=Eu, pr)
Can. J. Chem.
（Academic Journal
,1983
）
61
/
7
,
|
|
| 2.
|
Sulfur Dioxide Gas Detection with Na2SO4-Li2SO4-Y2(SO4)3-SiO2 solid Electrolyte by a Solid Reference Electrode Method
J. Electrochem. Soc.
（Academic Journal
,1987
）
134
/
3
,
|
|
| 3.
|
A Carbon Dioxide Gas Sensor Probe Based on a Lithium Ionic Conductor
Chem. Lett.
（Academic Journal
,1990
）
/
,
|
|
|
Research Result (publications)
(13cases) |
| 1.
|
Na2SO4 Doped with NaVO3 and/or Ln2(SO43(Ln=Rare Earths)as an SO2 Solid Electrolyte Sensor
（Kodansha and Elsevier
,1983
）
|
| 2.
|
A Solid Electrolyte for Sulfur Dioxide Detection-Sodium Sulfate Mixed with Rare Earth Sulfates and Silicon Dioxide
（ACS(American Chemical Society) Symposium Series
,1986
）
|
| 3.
|
Superconductivity of YBa2 Cu3 O7-x-Metal Composites
（World Scientific
,1989
）
|
| Further display
|
|
Research Result (patents)
(8cases) |
|
Research Result (other activities)
(4cases) |
| 1.
|
(CO2 Sensor with Solid Electrolyte)
（1993）
|
| 2.
|
(CO2 Detection with Solid Electrolyte Sensor)
（1993）
|
| 3.
|
CO2 Sensors using solid electrolytes
（1993）
|
| Further display
|
|
| Graduate School |
| 1.
|
Osaka University
Doctor
（Graduate School, Division of Engineering
）
1986
（Completed
）
|
|
| Graduating School |
| 1.
|
Osaka University
University
（Faculty of Engineering
）
1981
（Graduated
）
|
|
| Academic Degree |
|
